About 2-O-(2-methylpropyl) 1-O-pentyl oxalate
2-O-(2-methylpropyl) 1-O-pentyl oxalate (PubChem CID 6420703) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-O-(2-methylpropyl) 1-O-pentyl oxalate.
Molecular Properties
| Compound Name | 2-O-(2-methylpropyl) 1-O-pentyl oxalate |
| PubChem CID | 6420703 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-O-(2-methylpropyl) 1-O-pentyl oxalate |
| SMILES | CCCCCOC(=O)C(=O)OCC(C)C |
| InChI | InChI=1S/C11H20O4/c1-4-5-6-7-14-10(12)11(13)15-8-9(2)3/h9H,4-8H2,1-3H3 |
| InChIKey | LDNMUCYNVULZDI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-O-(2-methylpropyl) 1-O-pentyl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-(2-methylpropyl) 1-O-pentyl oxalate?
The IUPAC name of 2-O-(2-methylpropyl) 1-O-pentyl oxalate (CID 6420703) is 2-O-(2-methylpropyl) 1-O-pentyl oxalate.
What is the SMILES notation for 2-O-(2-methylpropyl) 1-O-pentyl oxalate?
The canonical SMILES for 2-O-(2-methylpropyl) 1-O-pentyl oxalate is CCCCCOC(=O)C(=O)OCC(C)C.
What is the InChIKey of 2-O-(2-methylpropyl) 1-O-pentyl oxalate?
The InChIKey is LDNMUCYNVULZDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-4-5-6-7-14-10(12)11(13)15-8-9(2)3/h9H,4-8H2,1-3H3.
What are the key properties of 2-O-(2-methylpropyl) 1-O-pentyl oxalate?
2-O-(2-methylpropyl) 1-O-pentyl oxalate has a molecular weight of 216.28 g/mol, XLogP of 1.92, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-(2-methylpropyl) 1-O-pentyl oxalate is sourced from PubChem (CID 6420703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).