C24H44O4 — CID 88549415
bis(2-methylpropyl) (Z)-2,3-dihexylbut-2-enedioate (PubChem CID 88549415) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is bis(2-methylpropyl) (Z)-2,3-dihexylbut-2-enedioate.
| Compound Name | bis(2-methylpropyl) (Z)-2,3-dihexylbut-2-enedioate |
|---|---|
| PubChem CID | 88549415 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | bis(2-methylpropyl) (Z)-2,3-dihexylbut-2-enedioate |
| SMILES | CCCCCC/C(C(=O)OCC(C)C)=C(\CCCCCC)C(=O)OCC(C)C |
| InChI | InChI=1S/C24H44O4/c1-7-9-11-13-15-21(23(25)27-17-19(3)4)22(16-14-12-10-8-2)24(26)28-18-20(5)6/h19-20H,7-18H2,1-6H3/b22-21- |
| InChIKey | FXBZWEDDDQKXDV-DQRAZIAOSA-N |
| XLogP | 6.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|