C25H46O4 — CID 123228560
bis(2-methylpropyl) 2-(2,2-dimethylpropyl)-3-octylbut-2-enedioate (PubChem CID 123228560) has the molecular formula C25H46O4 and a molecular weight of 410.64 g/mol. Its IUPAC name is bis(2-methylpropyl) 2-(2,2-dimethylpropyl)-3-octylbut-2-enedioate.
| Compound Name | bis(2-methylpropyl) 2-(2,2-dimethylpropyl)-3-octylbut-2-enedioate |
|---|---|
| PubChem CID | 123228560 |
| Molecular Formula | C25H46O4 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | bis(2-methylpropyl) 2-(2,2-dimethylpropyl)-3-octylbut-2-enedioate |
| SMILES | CCCCCCCCC(C(=O)OCC(C)C)=C(CC(C)(C)C)C(=O)OCC(C)C |
| InChI | InChI=1S/C25H46O4/c1-9-10-11-12-13-14-15-21(23(26)28-17-19(2)3)22(16-25(6,7)8)24(27)29-18-20(4)5/h19-20H,9-18H2,1-8H3 |
| InChIKey | LRESZXLNLGFXNB-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|