C20H36O4 — CID 123566634
bis(2-methylpropyl) 2-(2,2-dimethylpropyl)-3-propylbut-2-enedioate (PubChem CID 123566634) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is bis(2-methylpropyl) 2-(2,2-dimethylpropyl)-3-propylbut-2-enedioate.
| Compound Name | bis(2-methylpropyl) 2-(2,2-dimethylpropyl)-3-propylbut-2-enedioate |
|---|---|
| PubChem CID | 123566634 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | bis(2-methylpropyl) 2-(2,2-dimethylpropyl)-3-propylbut-2-enedioate |
| SMILES | CCCC(C(=O)OCC(C)C)=C(CC(C)(C)C)C(=O)OCC(C)C |
| InChI | InChI=1S/C20H36O4/c1-9-10-16(18(21)23-12-14(2)3)17(11-20(6,7)8)19(22)24-13-15(4)5/h14-15H,9-13H2,1-8H3 |
| InChIKey | SNXFJHHPRPHQKW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|