C22H40O4 — CID 22227592
bis(2-methylpropyl) (Z)-2,3-dipentylbut-2-enedioate (PubChem CID 22227592) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is bis(2-methylpropyl) (Z)-2,3-dipentylbut-2-enedioate.
| Compound Name | bis(2-methylpropyl) (Z)-2,3-dipentylbut-2-enedioate |
|---|---|
| PubChem CID | 22227592 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | bis(2-methylpropyl) (Z)-2,3-dipentylbut-2-enedioate |
| SMILES | CCCCC/C(C(=O)OCC(C)C)=C(\CCCCC)C(=O)OCC(C)C |
| InChI | InChI=1S/C22H40O4/c1-7-9-11-13-19(21(23)25-15-17(3)4)20(14-12-10-8-2)22(24)26-16-18(5)6/h17-18H,7-16H2,1-6H3/b20-19- |
| InChIKey | NCPPAVPRTMLCLD-VXPUYCOJSA-N |
| XLogP | 5.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|