About decyl 2,3-dihydroxypropyl carbonate
decyl 2,3-dihydroxypropyl carbonate (PubChem CID 11265856) has the molecular formula C14H28O5
and a molecular weight of 276.37 g/mol. Its IUPAC name is decyl 2,3-dihydroxypropyl carbonate.
Molecular Properties
| Compound Name | decyl 2,3-dihydroxypropyl carbonate |
| PubChem CID | 11265856 |
| Molecular Formula | C14H28O5 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | decyl 2,3-dihydroxypropyl carbonate |
| SMILES | CCCCCCCCCCOC(=O)OCC(O)CO |
| InChI | InChI=1S/C14H28O5/c1-2-3-4-5-6-7-8-9-10-18-14(17)19-12-13(16)11-15/h13,15-16H,2-12H2,1H3 |
| InChIKey | IGXGDVNXPKMQNI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decyl 2,3-dihydroxypropyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl 2,3-dihydroxypropyl carbonate?
The IUPAC name of decyl 2,3-dihydroxypropyl carbonate (CID 11265856) is decyl 2,3-dihydroxypropyl carbonate.
What is the SMILES notation for decyl 2,3-dihydroxypropyl carbonate?
The canonical SMILES for decyl 2,3-dihydroxypropyl carbonate is CCCCCCCCCCOC(=O)OCC(O)CO.
What is the InChIKey of decyl 2,3-dihydroxypropyl carbonate?
The InChIKey is IGXGDVNXPKMQNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O5/c1-2-3-4-5-6-7-8-9-10-18-14(17)19-12-13(16)11-15/h13,15-16H,2-12H2,1H3.
What are the key properties of decyl 2,3-dihydroxypropyl carbonate?
decyl 2,3-dihydroxypropyl carbonate has a molecular weight of 276.37 g/mol, XLogP of 2.63, 12 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for decyl 2,3-dihydroxypropyl carbonate is sourced from PubChem (CID 11265856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).