C6H12O5 — CID 87609123
2,3-dihydroxypropyl ethyl carbonate (PubChem CID 87609123) has the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. Its IUPAC name is 2,3-dihydroxypropyl ethyl carbonate.
| Compound Name | 2,3-dihydroxypropyl ethyl carbonate |
|---|---|
| PubChem CID | 87609123 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 2,3-dihydroxypropyl ethyl carbonate |
| SMILES | CCOC(=O)OCC(O)CO |
| InChI | InChI=1S/C6H12O5/c1-2-10-6(9)11-4-5(8)3-7/h5,7-8H,2-4H2,1H3 |
| InChIKey | NFTISWSKCODOLW-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |