C21H42O12 — CID 175822551
2,3-dihydroxypropyl butanoate (PubChem CID 175822551) has the molecular formula C21H42O12 and a molecular weight of 486.56 g/mol. Its IUPAC name is 2,3-dihydroxypropyl butanoate.
| Compound Name | 2,3-dihydroxypropyl butanoate |
|---|---|
| PubChem CID | 175822551 |
| Molecular Formula | C21H42O12 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 2,3-dihydroxypropyl butanoate |
| SMILES | CCCC(=O)OCC(O)CO.CCCC(=O)OCC(O)CO.CCCC(=O)OCC(O)CO |
| InChI | InChI=1S/3C7H14O4/c3*1-2-3-7(10)11-5-6(9)4-8/h3*6,8-9H,2-5H2,1H3 |
| InChIKey | BDQNULLDMWJRGU-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|