C30H56O14 — CID 173464045
butanoic acid;2,3-di(butanoyloxy)propyl butanoate;2,3-dihydroxypropyl butanoate (PubChem CID 173464045) has the molecular formula C30H56O14 and a molecular weight of 640.76 g/mol. Its IUPAC name is butanoic acid;2,3-di(butanoyloxy)propyl butanoate;2,3-dihydroxypropyl butanoate.
| Compound Name | butanoic acid;2,3-di(butanoyloxy)propyl butanoate;2,3-dihydroxypropyl butanoate |
|---|---|
| PubChem CID | 173464045 |
| Molecular Formula | C30H56O14 |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 640.37 |
| IUPAC Name | butanoic acid;2,3-di(butanoyloxy)propyl butanoate;2,3-dihydroxypropyl butanoate |
| SMILES | CCCC(=O)O.CCCC(=O)O.CCCC(=O)OCC(COC(=O)CCC)OC(=O)CCC.CCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C15H26O6.C7H14O4.2C4H8O2/c1-4-7-13(16)19-10-12(21-15(18)9-6-3)11-20-14(17)8-5-2;1-2-3-7(10)11-5-6(9)4-8;2*1-2-3-4(5)6/h12H,4-11H2,1-3H3;6,8-9H,2-5H2,1H3;2*2-3H2,1H3,(H,5,6) |
| InChIKey | ZZTLKPZGRMMGIL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 220.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|