C24H44O14 — CID 174547325
acetic acid;2,3-di(butanoyloxy)propyl butanoate;2,3-dihydroxypropyl acetate (PubChem CID 174547325) has the molecular formula C24H44O14 and a molecular weight of 556.60 g/mol. Its IUPAC name is acetic acid;2,3-di(butanoyloxy)propyl butanoate;2,3-dihydroxypropyl acetate.
| Compound Name | acetic acid;2,3-di(butanoyloxy)propyl butanoate;2,3-dihydroxypropyl acetate |
|---|---|
| PubChem CID | 174547325 |
| Molecular Formula | C24H44O14 |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | acetic acid;2,3-di(butanoyloxy)propyl butanoate;2,3-dihydroxypropyl acetate |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)OCC(O)CO.CCCC(=O)OCC(COC(=O)CCC)OC(=O)CCC |
| InChI | InChI=1S/C15H26O6.C5H10O4.2C2H4O2/c1-4-7-13(16)19-10-12(21-15(18)9-6-3)11-20-14(17)8-5-2;1-4(7)9-3-5(8)2-6;2*1-2(3)4/h12H,4-11H2,1-3H3;5-6,8H,2-3H2,1H3;2*1H3,(H,3,4) |
| InChIKey | OZTIDUACYUIRRI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 220.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|