C44H76NO4+ — CID 101335307
bis[(Z)-octadec-11-enyl] 1-methylpyridin-1-ium-3,5-dicarboxylate (PubChem CID 101335307) has the molecular formula C44H76NO4+ and a molecular weight of 683.10 g/mol. Its IUPAC name is bis[(Z)-octadec-11-enyl] 1-methylpyridin-1-ium-3,5-dicarboxylate.
| Compound Name | bis[(Z)-octadec-11-enyl] 1-methylpyridin-1-ium-3,5-dicarboxylate |
|---|---|
| PubChem CID | 101335307 |
| Molecular Formula | C44H76NO4+ |
| Molecular Weight | 683.10 g/mol |
| Exact Mass | 682.58 |
| IUPAC Name | bis[(Z)-octadec-11-enyl] 1-methylpyridin-1-ium-3,5-dicarboxylate |
| SMILES | CCCCCC/C=C\CCCCCCCCCCOC(=O)c1cc(C(=O)OCCCCCCCCCC/C=C\CCCCCC)c[n+](C)c1 |
| InChI | InChI=1S/C44H76NO4/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-48-43(46)41-38-42(40-45(3)39-41)44(47)49-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h14-17,38-40H,4-13,18-37H2,1-3H3/q+1/b16-14-,17-15- |
| InChIKey | BKIFRRAGTLJQRF-RYOQUFEFSA-N |
| XLogP | 12.90 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.10 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|