C12H14O7 — CID 169437924
diethyl 2,4,6-trihydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-dicarboxylate (PubChem CID 169437924) has the molecular formula C12H14O7 and a molecular weight of 278.18 g/mol. Its IUPAC name is diethyl 2,4,6-trihydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-dicarboxylate.
| Compound Name | diethyl 2,4,6-trihydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 169437924 |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | diethyl 2,4,6-trihydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-dicarboxylate |
| SMILES | CCO[13C](=O)[13c]1[13c](O)[13cH][13c](O)[13c]([13C](=O)OCC)[13c]1O |
| InChI | InChI=1S/C12H14O7/c1-3-18-11(16)8-6(13)5-7(14)9(10(8)15)12(17)19-4-2/h5,13-15H,3-4H2,1-2H3/i5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1 |
| InChIKey | QSCLDVJOTHIXFH-IUWCVXBVSA-N |
| XLogP | 1.16 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |