C11H14O5 — CID 10987943
ethyl 4,6-dihydroxy-3-methoxy-2-methylbenzoate (PubChem CID 10987943) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is ethyl 4,6-dihydroxy-3-methoxy-2-methylbenzoate.
| Compound Name | ethyl 4,6-dihydroxy-3-methoxy-2-methylbenzoate |
|---|---|
| PubChem CID | 10987943 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | ethyl 4,6-dihydroxy-3-methoxy-2-methylbenzoate |
| SMILES | CCOC(=O)c1c(O)cc(O)c(OC)c1C |
| InChI | InChI=1S/C11H14O5/c1-4-16-11(14)9-6(2)10(15-3)8(13)5-7(9)12/h5,12-13H,4H2,1-3H3 |
| InChIKey | UMBVKKVZFZYNPG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |