C15H15BrO4 — CID 97034479
ethyl 4-bromo-1,3-dimethoxynaphthalene-2-carboxylate (PubChem CID 97034479) has the molecular formula C15H15BrO4 and a molecular weight of 339.19 g/mol. Its IUPAC name is ethyl 4-bromo-1,3-dimethoxynaphthalene-2-carboxylate.
| Compound Name | ethyl 4-bromo-1,3-dimethoxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 97034479 |
| Molecular Formula | C15H15BrO4 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | ethyl 4-bromo-1,3-dimethoxynaphthalene-2-carboxylate |
| SMILES | CCOC(=O)c1c(OC)c(Br)c2ccccc2c1OC |
| InChI | InChI=1S/C15H15BrO4/c1-4-20-15(17)11-13(18-2)10-8-6-5-7-9(10)12(16)14(11)19-3/h5-8H,4H2,1-3H3 |
| InChIKey | HBSBATCNAIFMMU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |