C46H36O8 — CID 134962471
tetraethyl octacyclo[16.16.0.02,15.05,14.06,11.019,32.022,31.023,28]tetratriaconta-1(18),2,4,6,8,10,12,14,16,19,21,23,25,27,29,31,33-heptadecaene-3,4,20,21-tetracarboxylate (PubChem CID 134962471) has the molecular formula C46H36O8 and a molecular weight of 716.79 g/mol. Its IUPAC name is tetraethyl octacyclo[16.16.0.02,15.05,14.06,11.019,32.022,31.023,28]tetratriaconta-1(18),2,4,6,8,10,12,14,16,19,21,23,25,27,29,31,33-heptadecaene-3,4,20,21-tetracarboxylate.
| Compound Name | tetraethyl octacyclo[16.16.0.02,15.05,14.06,11.019,32.022,31.023,28]tetratriaconta-1(18),2,4,6,8,10,12,14,16,19,21,23,25,27,29,31,33-heptadecaene-3,4,20,21-tetracarboxylate |
|---|---|
| PubChem CID | 134962471 |
| Molecular Formula | C46H36O8 |
| Molecular Weight | 716.79 g/mol |
| Exact Mass | 716.24 |
| IUPAC Name | tetraethyl octacyclo[16.16.0.02,15.05,14.06,11.019,32.022,31.023,28]tetratriaconta-1(18),2,4,6,8,10,12,14,16,19,21,23,25,27,29,31,33-heptadecaene-3,4,20,21-tetracarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)c2c(ccc3c2ccc2c4ccc5ccccc5c4c(C(=O)OCC)c(C(=O)OCC)c23)c2ccc3ccccc3c12 |
| InChI | InChI=1S/C46H36O8/c1-5-51-43(47)39-35-27-15-11-9-13-25(27)17-19-29(35)31-21-24-34-33(37(31)41(39)45(49)53-7-3)23-22-32-30-20-18-26-14-10-12-16-28(26)36(30)40(44(48)52-6-2)42(38(32)34)46(50)54-8-4/h9-24H,5-8H2,1-4H3 |
| InChIKey | XBFKZOZXPPZBPK-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.79 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|