About ethyl acetate;phenanthrene
ethyl acetate;phenanthrene (PubChem CID 160726264) has the molecular formula C18H18O2
and a molecular weight of 266.34 g/mol. Its IUPAC name is ethyl acetate;phenanthrene.
Molecular Properties
| Compound Name | ethyl acetate;phenanthrene |
| PubChem CID | 160726264 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | ethyl acetate;phenanthrene |
| SMILES | CCOC(C)=O.c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C14H10.C4H8O2/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-3-6-4(2)5/h1-10H;3H2,1-2H3 |
| InChIKey | RTTHCQPLBBOJQF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze ethyl acetate;phenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;phenanthrene?
The IUPAC name of ethyl acetate;phenanthrene (CID 160726264) is ethyl acetate;phenanthrene.
What is the SMILES notation for ethyl acetate;phenanthrene?
The canonical SMILES for ethyl acetate;phenanthrene is CCOC(C)=O.c1ccc2c(c1)ccc1ccccc12.
What is the InChIKey of ethyl acetate;phenanthrene?
The InChIKey is RTTHCQPLBBOJQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C4H8O2/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-3-6-4(2)5/h1-10H;3H2,1-2H3.
What are the key properties of ethyl acetate;phenanthrene?
ethyl acetate;phenanthrene has a molecular weight of 266.34 g/mol, XLogP of 4.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;phenanthrene is sourced from PubChem (CID 160726264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).