About 1-bromonaphthalene;ethyl acetate
1-bromonaphthalene;ethyl acetate (PubChem CID 174701455) has the molecular formula C14H15BrO2
and a molecular weight of 295.18 g/mol. Its IUPAC name is 1-bromonaphthalene;ethyl acetate.
Molecular Properties
| Compound Name | 1-bromonaphthalene;ethyl acetate |
| PubChem CID | 174701455 |
| Molecular Formula | C14H15BrO2 |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 1-bromonaphthalene;ethyl acetate |
| SMILES | Brc1cccc2ccccc12.CCOC(C)=O |
| InChI | InChI=1S/C10H7Br.C4H8O2/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-3-6-4(2)5/h1-7H;3H2,1-2H3 |
| InChIKey | KNOAZXVHLIKASY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromonaphthalene;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromonaphthalene;ethyl acetate?
The IUPAC name of 1-bromonaphthalene;ethyl acetate (CID 174701455) is 1-bromonaphthalene;ethyl acetate.
What is the SMILES notation for 1-bromonaphthalene;ethyl acetate?
The canonical SMILES for 1-bromonaphthalene;ethyl acetate is Brc1cccc2ccccc12.CCOC(C)=O.
What is the InChIKey of 1-bromonaphthalene;ethyl acetate?
The InChIKey is KNOAZXVHLIKASY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Br.C4H8O2/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-3-6-4(2)5/h1-7H;3H2,1-2H3.
What are the key properties of 1-bromonaphthalene;ethyl acetate?
1-bromonaphthalene;ethyl acetate has a molecular weight of 295.18 g/mol, XLogP of 4.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromonaphthalene;ethyl acetate is sourced from PubChem (CID 174701455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).