C34H28Br2O4 — CID 139120910
(1S,4S)-1,4-bis(4-bromonaphthalen-1-yl)naphthalene-1,4-diol;ethyl acetate (PubChem CID 139120910) has the molecular formula C34H28Br2O4 and a molecular weight of 660.40 g/mol. Its IUPAC name is (1S,4S)-1,4-bis(4-bromonaphthalen-1-yl)naphthalene-1,4-diol;ethyl acetate.
| Compound Name | (1S,4S)-1,4-bis(4-bromonaphthalen-1-yl)naphthalene-1,4-diol;ethyl acetate |
|---|---|
| PubChem CID | 139120910 |
| Molecular Formula | C34H28Br2O4 |
| Molecular Weight | 660.40 g/mol |
| Exact Mass | 658.04 |
| IUPAC Name | (1S,4S)-1,4-bis(4-bromonaphthalen-1-yl)naphthalene-1,4-diol;ethyl acetate |
| SMILES | CCOC(C)=O.O[C@]1(c2ccc(Br)c3ccccc23)C=C[C@](O)(c2ccc(Br)c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C30H20Br2O2.C4H8O2/c31-27-15-13-23(19-7-1-3-9-21(19)27)29(33)17-18-30(34,26-12-6-5-11-25(26)29)24-14-16-28(32)22-10-4-2-8-20(22)24;1-3-6-4(2)5/h1-18,33-34H;3H2,1-2H3/t29-,30-;/m0./s1 |
| InChIKey | WXZWVSYCJYJJNT-PNHSAAKESA-N |
| XLogP | 8.13 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.40 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|