C19H19BrO4 — CID 70405514
diethyl 6-bromo-1,3-dihydrophenalene-2,2-dicarboxylate (PubChem CID 70405514) has the molecular formula C19H19BrO4 and a molecular weight of 391.26 g/mol. Its IUPAC name is diethyl 6-bromo-1,3-dihydrophenalene-2,2-dicarboxylate.
| Compound Name | diethyl 6-bromo-1,3-dihydrophenalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 70405514 |
| Molecular Formula | C19H19BrO4 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | diethyl 6-bromo-1,3-dihydrophenalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2cccc3c(Br)ccc(c23)C1 |
| InChI | InChI=1S/C19H19BrO4/c1-3-23-17(21)19(18(22)24-4-2)10-12-6-5-7-14-15(20)9-8-13(11-19)16(12)14/h5-9H,3-4,10-11H2,1-2H3 |
| InChIKey | IZRNZOKHXYLFLN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|