C23H24O4 — CID 14713456
diethyl (4Z)-4-benzylidene-1,3-dihydronaphthalene-2,2-dicarboxylate (PubChem CID 14713456) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is diethyl (4Z)-4-benzylidene-1,3-dihydronaphthalene-2,2-dicarboxylate.
| Compound Name | diethyl (4Z)-4-benzylidene-1,3-dihydronaphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 14713456 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | diethyl (4Z)-4-benzylidene-1,3-dihydronaphthalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C/C(=C/c2ccccc2)c2ccccc2C1 |
| InChI | InChI=1S/C23H24O4/c1-3-26-21(24)23(22(25)27-4-2)15-18-12-8-9-13-20(18)19(16-23)14-17-10-6-5-7-11-17/h5-14H,3-4,15-16H2,1-2H3/b19-14- |
| InChIKey | AHOUXLZHLGAGOK-RGEXLXHISA-N |
| XLogP | 4.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|