C45H54O12 — CID 15782308
hexaethyl tetracyclo[19.3.1.15,9.113,17]heptacosa-1(25),5(27),6,8,13,15,17(26),21,23-nonaene-3,3,11,11,19,19-hexacarboxylate (PubChem CID 15782308) has the molecular formula C45H54O12 and a molecular weight of 786.91 g/mol. Its IUPAC name is hexaethyl tetracyclo[19.3.1.15,9.113,17]heptacosa-1(25),5(27),6,8,13,15,17(26),21,23-nonaene-3,3,11,11,19,19-hexacarboxylate.
| Compound Name | hexaethyl tetracyclo[19.3.1.15,9.113,17]heptacosa-1(25),5(27),6,8,13,15,17(26),21,23-nonaene-3,3,11,11,19,19-hexacarboxylate |
|---|---|
| PubChem CID | 15782308 |
| Molecular Formula | C45H54O12 |
| Molecular Weight | 786.91 g/mol |
| Exact Mass | 786.36 |
| IUPAC Name | hexaethyl tetracyclo[19.3.1.15,9.113,17]heptacosa-1(25),5(27),6,8,13,15,17(26),21,23-nonaene-3,3,11,11,19,19-hexacarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2cccc(c2)CC(C(=O)OCC)(C(=O)OCC)Cc2cccc(c2)CC(C(=O)OCC)(C(=O)OCC)Cc2cccc(c2)C1 |
| InChI | InChI=1S/C45H54O12/c1-7-52-37(46)43(38(47)53-8-2)25-31-16-13-18-33(22-31)27-44(39(48)54-9-3,40(49)55-10-4)29-35-20-15-21-36(24-35)30-45(41(50)56-11-5,42(51)57-12-6)28-34-19-14-17-32(23-34)26-43/h13-24H,7-12,25-30H2,1-6H3 |
| InChIKey | AUSQDDFOKKLVHJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.91 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|