C20H22O5 — CID 102275271
diethyl (3Z)-3-[(2-formylphenyl)methylidene]-4-methylidenecyclopentane-1,1-dicarboxylate (PubChem CID 102275271) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is diethyl (3Z)-3-[(2-formylphenyl)methylidene]-4-methylidenecyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl (3Z)-3-[(2-formylphenyl)methylidene]-4-methylidenecyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102275271 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | diethyl (3Z)-3-[(2-formylphenyl)methylidene]-4-methylidenecyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)C/C1=C/c1ccccc1C=O |
| InChI | InChI=1S/C20H22O5/c1-4-24-18(22)20(19(23)25-5-2)11-14(3)17(12-20)10-15-8-6-7-9-16(15)13-21/h6-10,13H,3-5,11-12H2,1-2H3/b17-10- |
| InChIKey | MLSVEMFROKNQFN-YVLHZVERSA-N |
| XLogP | 3.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|