About diethyl 5-benzylidene-1,3-dihydropentalene-2,2-dicarboxylate
diethyl 5-benzylidene-1,3-dihydropentalene-2,2-dicarboxylate (PubChem CID 10871472) has the molecular formula C21H22O4
and a molecular weight of 338.40 g/mol. Its IUPAC name is diethyl 5-benzylidene-1,3-dihydropentalene-2,2-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 5-benzylidene-1,3-dihydropentalene-2,2-dicarboxylate |
| PubChem CID | 10871472 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | diethyl 5-benzylidene-1,3-dihydropentalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=CC(=Cc3ccccc3)C=C2C1 |
| InChI | InChI=1S/C21H22O4/c1-3-24-19(22)21(20(23)25-4-2)13-17-11-16(12-18(17)14-21)10-15-8-6-5-7-9-15/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | MGGIOEGSLOVUKW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 5-benzylidene-1,3-dihydropentalene-2,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 5-benzylidene-1,3-dihydropentalene-2,2-dicarboxylate?
The IUPAC name of diethyl 5-benzylidene-1,3-dihydropentalene-2,2-dicarboxylate (CID 10871472) is diethyl 5-benzylidene-1,3-dihydropentalene-2,2-dicarboxylate.
What is the SMILES notation for diethyl 5-benzylidene-1,3-dihydropentalene-2,2-dicarboxylate?
The canonical SMILES for diethyl 5-benzylidene-1,3-dihydropentalene-2,2-dicarboxylate is CCOC(=O)C1(C(=O)OCC)CC2=CC(=Cc3ccccc3)C=C2C1.
What is the InChIKey of diethyl 5-benzylidene-1,3-dihydropentalene-2,2-dicarboxylate?
The InChIKey is MGGIOEGSLOVUKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22O4/c1-3-24-19(22)21(20(23)25-4-2)13-17-11-16(12-18(17)14-21)10-15-8-6-5-7-9-15/h5-12H,3-4,13-14H2,1-2H3.
What are the key properties of diethyl 5-benzylidene-1,3-dihydropentalene-2,2-dicarboxylate?
diethyl 5-benzylidene-1,3-dihydropentalene-2,2-dicarboxylate has a molecular weight of 338.40 g/mol, XLogP of 3.84, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 5-benzylidene-1,3-dihydropentalene-2,2-dicarboxylate is sourced from PubChem (CID 10871472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).