C19H24O5 — CID 177406220
cis-diethyl (3R,4R)-4-ethenyl-3-hydroxy-3-phenylcyclopentane-1,1-dicarboxylate (PubChem CID 177406220) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is cis-diethyl (3R,4R)-4-ethenyl-3-hydroxy-3-phenylcyclopentane-1,1-dicarboxylate.
| Compound Name | cis-diethyl (3R,4R)-4-ethenyl-3-hydroxy-3-phenylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 177406220 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | cis-diethyl (3R,4R)-4-ethenyl-3-hydroxy-3-phenylcyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OCC)(C(=O)OCC)C[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C19H24O5/c1-4-14-12-18(16(20)23-5-2,17(21)24-6-3)13-19(14,22)15-10-8-7-9-11-15/h4,7-11,14,22H,1,5-6,12-13H2,2-3H3/t14-,19+/m0/s1 |
| InChIKey | RLTILXFILNGSGV-IFXJQAMLSA-N |
| XLogP | 2.58 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|