C24H32O4 — CID 177396679
trans-diethyl (3S,4S)-3-ethenyl-4-[(E)-3-methyl-1-phenylbut-1-enyl]cyclopentane-1,1-dicarboxylate (PubChem CID 177396679) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is trans-diethyl (3S,4S)-3-ethenyl-4-[(E)-3-methyl-1-phenylbut-1-enyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (3S,4S)-3-ethenyl-4-[(E)-3-methyl-1-phenylbut-1-enyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 177396679 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | trans-diethyl (3S,4S)-3-ethenyl-4-[(E)-3-methyl-1-phenylbut-1-enyl]cyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@@H]1CC(C(=O)OCC)(C(=O)OCC)C[C@@H]1/C(=C\C(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H32O4/c1-6-18-15-24(22(25)27-7-2,23(26)28-8-3)16-21(18)20(14-17(4)5)19-12-10-9-11-13-19/h6,9-14,17-18,21H,1,7-8,15-16H2,2-5H3/b20-14-/t18-,21+/m1/s1 |
| InChIKey | PFOKJHAVURJHAG-MKNFGOCHSA-N |
| XLogP | 5.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|