C20H23NO4 — CID 102314186
diethyl (1R)-1-ethenyl-1,2,4,9-tetrahydrocarbazole-3,3-dicarboxylate (PubChem CID 102314186) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is diethyl (1R)-1-ethenyl-1,2,4,9-tetrahydrocarbazole-3,3-dicarboxylate.
| Compound Name | diethyl (1R)-1-ethenyl-1,2,4,9-tetrahydrocarbazole-3,3-dicarboxylate |
|---|---|
| PubChem CID | 102314186 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | diethyl (1R)-1-ethenyl-1,2,4,9-tetrahydrocarbazole-3,3-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OCC)(C(=O)OCC)Cc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C20H23NO4/c1-4-13-11-20(18(22)24-5-2,19(23)25-6-3)12-15-14-9-7-8-10-16(14)21-17(13)15/h4,7-10,13,21H,1,5-6,11-12H2,2-3H3/t13-/m0/s1 |
| InChIKey | NBSSAULTSKGEMH-ZDUSSCGKSA-N |
| XLogP | 3.50 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|