C22H25NO4 — CID 122379673
diethyl (4R)-4-ethenyl-2-phenyl-1,4,5,7-tetrahydroindole-6,6-dicarboxylate (PubChem CID 122379673) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is diethyl (4R)-4-ethenyl-2-phenyl-1,4,5,7-tetrahydroindole-6,6-dicarboxylate.
| Compound Name | diethyl (4R)-4-ethenyl-2-phenyl-1,4,5,7-tetrahydroindole-6,6-dicarboxylate |
|---|---|
| PubChem CID | 122379673 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | diethyl (4R)-4-ethenyl-2-phenyl-1,4,5,7-tetrahydroindole-6,6-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OCC)(C(=O)OCC)Cc2[nH]c(-c3ccccc3)cc21 |
| InChI | InChI=1S/C22H25NO4/c1-4-15-13-22(20(24)26-5-2,21(25)27-6-3)14-19-17(15)12-18(23-19)16-10-8-7-9-11-16/h4,7-12,15,23H,1,5-6,13-14H2,2-3H3/t15-/m0/s1 |
| InChIKey | GQGZJTYKIKNQTC-HNNXBMFYSA-N |
| XLogP | 4.01 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|