C33H29FO4 — CID 122203109
diethyl 4-fluoro-5,6,7-triphenyl-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 122203109) has the molecular formula C33H29FO4 and a molecular weight of 508.59 g/mol. Its IUPAC name is diethyl 4-fluoro-5,6,7-triphenyl-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | diethyl 4-fluoro-5,6,7-triphenyl-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 122203109 |
| Molecular Formula | C33H29FO4 |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | diethyl 4-fluoro-5,6,7-triphenyl-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2c(F)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2C1 |
| InChI | InChI=1S/C33H29FO4/c1-3-37-31(35)33(32(36)38-4-2)20-25-26(21-33)30(34)29(24-18-12-7-13-19-24)28(23-16-10-6-11-17-23)27(25)22-14-8-5-9-15-22/h5-19H,3-4,20-21H2,1-2H3 |
| InChIKey | IVGVFWKCSFADAA-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|