C32H34O6 — CID 122206064
trimethyl 6-pentyl-4,7-diphenyl-1,3-dihydroindene-2,2,5-tricarboxylate (PubChem CID 122206064) has the molecular formula C32H34O6 and a molecular weight of 514.62 g/mol. Its IUPAC name is trimethyl 6-pentyl-4,7-diphenyl-1,3-dihydroindene-2,2,5-tricarboxylate.
| Compound Name | trimethyl 6-pentyl-4,7-diphenyl-1,3-dihydroindene-2,2,5-tricarboxylate |
|---|---|
| PubChem CID | 122206064 |
| Molecular Formula | C32H34O6 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | trimethyl 6-pentyl-4,7-diphenyl-1,3-dihydroindene-2,2,5-tricarboxylate |
| SMILES | CCCCCc1c(C(=O)OC)c(-c2ccccc2)c2c(c1-c1ccccc1)CC(C(=O)OC)(C(=O)OC)C2 |
| InChI | InChI=1S/C32H34O6/c1-5-6-9-18-23-26(21-14-10-7-11-15-21)24-19-32(30(34)37-3,31(35)38-4)20-25(24)27(28(23)29(33)36-2)22-16-12-8-13-17-22/h7-8,10-17H,5-6,9,18-20H2,1-4H3 |
| InChIKey | QTFNUAPTLZMVMX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|