C24H20O5 — CID 11165142
dimethyl 5-oxo-4,6-diphenyl-1,3-dihydropentalene-2,2-dicarboxylate (PubChem CID 11165142) has the molecular formula C24H20O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is dimethyl 5-oxo-4,6-diphenyl-1,3-dihydropentalene-2,2-dicarboxylate.
| Compound Name | dimethyl 5-oxo-4,6-diphenyl-1,3-dihydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 11165142 |
| Molecular Formula | C24H20O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | dimethyl 5-oxo-4,6-diphenyl-1,3-dihydropentalene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C(c3ccccc3)C(=O)C(c3ccccc3)=C2C1 |
| InChI | InChI=1S/C24H20O5/c1-28-22(26)24(23(27)29-2)13-17-18(14-24)20(16-11-7-4-8-12-16)21(25)19(17)15-9-5-3-6-10-15/h3-12H,13-14H2,1-2H3 |
| InChIKey | WBMASWJSCNNEEX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|