C19H19NO4S — CID 101357266
dimethyl 1-methyl-3-phenylimino-5,7-dihydrocyclopenta[c]thiopyran-6,6-dicarboxylate (PubChem CID 101357266) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is dimethyl 1-methyl-3-phenylimino-5,7-dihydrocyclopenta[c]thiopyran-6,6-dicarboxylate.
| Compound Name | dimethyl 1-methyl-3-phenylimino-5,7-dihydrocyclopenta[c]thiopyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 101357266 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | dimethyl 1-methyl-3-phenylimino-5,7-dihydrocyclopenta[c]thiopyran-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2c/c(=N/c3ccccc3)sc(C)c2C1 |
| InChI | InChI=1S/C19H19NO4S/c1-12-15-11-19(17(21)23-2,18(22)24-3)10-13(15)9-16(25-12)20-14-7-5-4-6-8-14/h4-9H,10-11H2,1-3H3/b20-16- |
| InChIKey | ATMLHJLCSAAAOY-SILNSSARSA-N |
| XLogP | 2.72 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|