C23H23NO8 — CID 102483815
tetramethyl 4-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),2,4,9(16),10(14)-pentaene-7,7,12,12-tetracarboxylate (PubChem CID 102483815) has the molecular formula C23H23NO8 and a molecular weight of 441.44 g/mol. Its IUPAC name is tetramethyl 4-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),2,4,9(16),10(14)-pentaene-7,7,12,12-tetracarboxylate.
| Compound Name | tetramethyl 4-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),2,4,9(16),10(14)-pentaene-7,7,12,12-tetracarboxylate |
|---|---|
| PubChem CID | 102483815 |
| Molecular Formula | C23H23NO8 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | tetramethyl 4-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),2,4,9(16),10(14)-pentaene-7,7,12,12-tetracarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc3ccnc4c3c(c2C1)CC(C(=O)OC)(C(=O)OC)C4 |
| InChI | InChI=1S/C23H23NO8/c1-29-18(25)22(19(26)30-2)8-13-7-12-5-6-24-16-11-23(20(27)31-3,21(28)32-4)10-15(17(12)16)14(13)9-22/h5-7H,8-11H2,1-4H3 |
| InChIKey | FZRCKUDTGWKJDZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 118.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|