C16H22ClNO4Si — CID 101408805
dimethyl 3-(chloromethyl)-1-trimethylsilyl-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate (PubChem CID 101408805) has the molecular formula C16H22ClNO4Si and a molecular weight of 355.89 g/mol. Its IUPAC name is dimethyl 3-(chloromethyl)-1-trimethylsilyl-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate.
| Compound Name | dimethyl 3-(chloromethyl)-1-trimethylsilyl-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 101408805 |
| Molecular Formula | C16H22ClNO4Si |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | dimethyl 3-(chloromethyl)-1-trimethylsilyl-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc(CCl)nc([Si](C)(C)C)c2C1 |
| InChI | InChI=1S/C16H22ClNO4Si/c1-21-14(19)16(15(20)22-2)7-10-6-11(9-17)18-13(12(10)8-16)23(3,4)5/h6H,7-9H2,1-5H3 |
| InChIKey | UYOLJUIGQJJVAR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|