C22H32O5Si2 — CID 71680037
dimethyl 6-methoxy-5-trimethylsilyl-4-(2-trimethylsilylethynyl)-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 71680037) has the molecular formula C22H32O5Si2 and a molecular weight of 432.67 g/mol. Its IUPAC name is dimethyl 6-methoxy-5-trimethylsilyl-4-(2-trimethylsilylethynyl)-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | dimethyl 6-methoxy-5-trimethylsilyl-4-(2-trimethylsilylethynyl)-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 71680037 |
| Molecular Formula | C22H32O5Si2 |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | dimethyl 6-methoxy-5-trimethylsilyl-4-(2-trimethylsilylethynyl)-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc(OC)c([Si](C)(C)C)c(C#C[Si](C)(C)C)c2C1 |
| InChI | InChI=1S/C22H32O5Si2/c1-25-18-12-15-13-22(20(23)26-2,21(24)27-3)14-17(15)16(10-11-28(4,5)6)19(18)29(7,8)9/h12H,13-14H2,1-9H3 |
| InChIKey | NEKMPNLWRZKPAO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|