C13H18O2Si — CID 11160666
2-(3,4-dimethoxyphenyl)ethynyl-trimethylsilane (PubChem CID 11160666) has the molecular formula C13H18O2Si and a molecular weight of 234.37 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethynyl-trimethylsilane.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11160666 |
| Molecular Formula | C13H18O2Si |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethynyl-trimethylsilane |
| SMILES | COc1ccc(C#C[Si](C)(C)C)cc1OC |
| InChI | InChI=1S/C13H18O2Si/c1-14-12-7-6-11(10-13(12)15-2)8-9-16(3,4)5/h6-7,10H,1-5H3 |
| InChIKey | LYTVGESGELVQRK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|