C23H18N2O3 — CID 171920307
2-[2-(3,4-dimethoxyphenyl)ethynyl]-6-[2-(4-methoxyphenyl)ethynyl]pyrazine (PubChem CID 171920307) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethynyl]-6-[2-(4-methoxyphenyl)ethynyl]pyrazine.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethynyl]-6-[2-(4-methoxyphenyl)ethynyl]pyrazine |
|---|---|
| PubChem CID | 171920307 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethynyl]-6-[2-(4-methoxyphenyl)ethynyl]pyrazine |
| SMILES | COc1ccc(C#Cc2cncc(C#Cc3ccc(OC)c(OC)c3)n2)cc1 |
| InChI | InChI=1S/C23H18N2O3/c1-26-21-11-6-17(7-12-21)4-9-19-15-24-16-20(25-19)10-5-18-8-13-22(27-2)23(14-18)28-3/h6-8,11-16H,1-3H3 |
| InChIKey | BPWRJFLKSKGDGF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|