C24H18O2 — CID 170459723
1,3-bis[2-(4-methoxyphenyl)ethynyl]benzene (PubChem CID 170459723) has the molecular formula C24H18O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1,3-bis[2-(4-methoxyphenyl)ethynyl]benzene.
| Compound Name | 1,3-bis[2-(4-methoxyphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 170459723 |
| Molecular Formula | C24H18O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1,3-bis[2-(4-methoxyphenyl)ethynyl]benzene |
| SMILES | COc1ccc(C#Cc2cccc(C#Cc3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C24H18O2/c1-25-23-14-10-19(11-15-23)6-8-21-4-3-5-22(18-21)9-7-20-12-16-24(26-2)17-13-20/h3-5,10-18H,1-2H3 |
| InChIKey | ITMJDNOHIOONQQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|