C48H34O4 — CID 102282889
1-[3,5-bis[2-(4-methoxyphenyl)ethynyl]phenyl]-3,5-bis[2-(4-methoxyphenyl)ethynyl]benzene (PubChem CID 102282889) has the molecular formula C48H34O4 and a molecular weight of 674.80 g/mol. Its IUPAC name is 1-[3,5-bis[2-(4-methoxyphenyl)ethynyl]phenyl]-3,5-bis[2-(4-methoxyphenyl)ethynyl]benzene.
| Compound Name | 1-[3,5-bis[2-(4-methoxyphenyl)ethynyl]phenyl]-3,5-bis[2-(4-methoxyphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 102282889 |
| Molecular Formula | C48H34O4 |
| Molecular Weight | 674.80 g/mol |
| Exact Mass | 674.25 |
| IUPAC Name | 1-[3,5-bis[2-(4-methoxyphenyl)ethynyl]phenyl]-3,5-bis[2-(4-methoxyphenyl)ethynyl]benzene |
| SMILES | COc1ccc(C#Cc2cc(C#Cc3ccc(OC)cc3)cc(-c3cc(C#Cc4ccc(OC)cc4)cc(C#Cc4ccc(OC)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C48H34O4/c1-49-45-21-13-35(14-22-45)5-9-39-29-40(10-6-36-15-23-46(50-2)24-16-36)32-43(31-39)44-33-41(11-7-37-17-25-47(51-3)26-18-37)30-42(34-44)12-8-38-19-27-48(52-4)28-20-38/h13-34H,1-4H3 |
| InChIKey | HNMMFVCYOHFGQN-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.80 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|