C72H56O8 — CID 101073094
(1Z,3Z,5Z,7Z)-1,2,5,6-tetrakis(4-methoxyphenyl)-3,4,7,8-tetrakis[2-(4-methoxyphenyl)ethynyl]cycloocta-1,3,5,7-tetraene (PubChem CID 101073094) has the molecular formula C72H56O8 and a molecular weight of 1049.23 g/mol. Its IUPAC name is (1Z,3Z,5Z,7Z)-1,2,5,6-tetrakis(4-methoxyphenyl)-3,4,7,8-tetrakis[2-(4-methoxyphenyl)ethynyl]cycloocta-1,3,5,7-tetraene.
| Compound Name | (1Z,3Z,5Z,7Z)-1,2,5,6-tetrakis(4-methoxyphenyl)-3,4,7,8-tetrakis[2-(4-methoxyphenyl)ethynyl]cycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 101073094 |
| Molecular Formula | C72H56O8 |
| Molecular Weight | 1049.23 g/mol |
| Exact Mass | 1048.40 |
| IUPAC Name | (1Z,3Z,5Z,7Z)-1,2,5,6-tetrakis(4-methoxyphenyl)-3,4,7,8-tetrakis[2-(4-methoxyphenyl)ethynyl]cycloocta-1,3,5,7-tetraene |
| SMILES | COc1ccc(C#CC2=C(C#Cc3ccc(OC)cc3)/C(c3ccc(OC)cc3)=C(c3ccc(OC)cc3)\C(C#Cc3ccc(OC)cc3)=C(C#Cc3ccc(OC)cc3)/C(c3ccc(OC)cc3)=C\2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C72H56O8/c1-73-57-29-9-49(10-30-57)17-45-65-66(46-18-50-11-31-58(74-2)32-12-50)70(54-23-39-62(78-6)40-24-54)72(56-27-43-64(80-8)44-28-56)68(48-20-52-15-35-60(76-4)36-16-52)67(47-19-51-13-33-59(75-3)34-14-51)71(55-25-41-63(79-7)42-26-55)69(65)53-21-37-61(77-5)38-22-53/h9-16,21-44H,1-8H3/b66-65-,68-67-,69-65-,70-66-,71-67-,71-69-,72-68-,72-70- |
| InChIKey | WNROYWMGOASBQX-PAIQDQGJSA-N |
| XLogP | 14.09 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.23 |
| LogP ≤ 5 | 14.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|