C24H20NO2+ — CID 71606234
2,6-bis[2-(4-methoxyphenyl)ethynyl]-1-methylpyridin-1-ium (PubChem CID 71606234) has the molecular formula C24H20NO2+ and a molecular weight of 354.43 g/mol. Its IUPAC name is 2,6-bis[2-(4-methoxyphenyl)ethynyl]-1-methylpyridin-1-ium.
| Compound Name | 2,6-bis[2-(4-methoxyphenyl)ethynyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 71606234 |
| Molecular Formula | C24H20NO2+ |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2,6-bis[2-(4-methoxyphenyl)ethynyl]-1-methylpyridin-1-ium |
| SMILES | COc1ccc(C#Cc2cccc(C#Cc3ccc(OC)cc3)[n+]2C)cc1 |
| InChI | InChI=1S/C24H20NO2/c1-25-21(13-7-19-9-15-23(26-2)16-10-19)5-4-6-22(25)14-8-20-11-17-24(27-3)18-12-20/h4-6,9-12,15-18H,1-3H3/q+1 |
| InChIKey | VJYQGPSXZTVHCX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|