C42H36N2O2 — CID 18996688
N-(4-methoxyphenyl)-N-[4-[2-[4-(N-(4-methoxyphenyl)-4-methylanilino)phenyl]ethynyl]phenyl]-4-methylaniline (PubChem CID 18996688) has the molecular formula C42H36N2O2 and a molecular weight of 600.76 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N-[4-[2-[4-(N-(4-methoxyphenyl)-4-methylanilino)phenyl]ethynyl]phenyl]-4-methylaniline.
| Compound Name | N-(4-methoxyphenyl)-N-[4-[2-[4-(N-(4-methoxyphenyl)-4-methylanilino)phenyl]ethynyl]phenyl]-4-methylaniline |
|---|---|
| PubChem CID | 18996688 |
| Molecular Formula | C42H36N2O2 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | N-(4-methoxyphenyl)-N-[4-[2-[4-(N-(4-methoxyphenyl)-4-methylanilino)phenyl]ethynyl]phenyl]-4-methylaniline |
| SMILES | COc1ccc(N(c2ccc(C)cc2)c2ccc(C#Cc3ccc(N(c4ccc(C)cc4)c4ccc(OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H36N2O2/c1-31-5-15-35(16-6-31)43(39-23-27-41(45-3)28-24-39)37-19-11-33(12-20-37)9-10-34-13-21-38(22-14-34)44(36-17-7-32(2)8-18-36)40-25-29-42(46-4)30-26-40/h5-8,11-30H,1-4H3 |
| InChIKey | AGRVMWWZRSRLQX-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|