C50H42N2O6 — CID 58098240
methyl (E)-3-acetyl-5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-2-[2-[4-(N-(4-methoxyphenyl)-4-methylanilino)phenyl]ethynyl]pent-2-en-4-ynoate (PubChem CID 58098240) has the molecular formula C50H42N2O6 and a molecular weight of 766.89 g/mol. Its IUPAC name is methyl (E)-3-acetyl-5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-2-[2-[4-(N-(4-methoxyphenyl)-4-methylanilino)phenyl]ethynyl]pent-2-en-4-ynoate.
| Compound Name | methyl (E)-3-acetyl-5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-2-[2-[4-(N-(4-methoxyphenyl)-4-methylanilino)phenyl]ethynyl]pent-2-en-4-ynoate |
|---|---|
| PubChem CID | 58098240 |
| Molecular Formula | C50H42N2O6 |
| Molecular Weight | 766.89 g/mol |
| Exact Mass | 766.30 |
| IUPAC Name | methyl (E)-3-acetyl-5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-2-[2-[4-(N-(4-methoxyphenyl)-4-methylanilino)phenyl]ethynyl]pent-2-en-4-ynoate |
| SMILES | COC(=O)/C(C#Cc1ccc(N(c2ccc(C)cc2)c2ccc(OC)cc2)cc1)=C(\C#Cc1ccc(N(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1)C(C)=O |
| InChI | InChI=1S/C50H42N2O6/c1-35-7-15-39(16-8-35)51(42-21-27-45(55-3)28-22-42)40-19-11-38(12-20-40)14-34-49(50(54)58-6)48(36(2)53)33-13-37-9-17-41(18-10-37)52(43-23-29-46(56-4)30-24-43)44-25-31-47(57-5)32-26-44/h7-12,15-32H,1-6H3/b49-48+ |
| InChIKey | BNXISRMXDMQATK-DSIMXMMZSA-N |
| XLogP | 10.42 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.89 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|