C48H38N2O8 — CID 87646415
(Z)-2,3-bis[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]but-2-enedioic acid (PubChem CID 87646415) has the molecular formula C48H38N2O8 and a molecular weight of 770.84 g/mol. Its IUPAC name is (Z)-2,3-bis[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]but-2-enedioic acid.
| Compound Name | (Z)-2,3-bis[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 87646415 |
| Molecular Formula | C48H38N2O8 |
| Molecular Weight | 770.84 g/mol |
| Exact Mass | 770.26 |
| IUPAC Name | (Z)-2,3-bis[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]but-2-enedioic acid |
| SMILES | COc1ccc(N(c2ccc(C#C/C(C(=O)O)=C(\C#Cc3ccc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc3)C(=O)O)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C48H38N2O8/c1-55-41-23-15-37(16-24-41)49(38-17-25-42(56-2)26-18-38)35-11-5-33(6-12-35)9-31-45(47(51)52)46(48(53)54)32-10-34-7-13-36(14-8-34)50(39-19-27-43(57-3)28-20-39)40-21-29-44(58-4)30-22-40/h5-8,11-30H,1-4H3,(H,51,52)(H,53,54)/b46-45- |
| InChIKey | SEZBZAMSHWUPQB-KZXRXFMCSA-N |
| XLogP | 9.53 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.84 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|