C42H38N4O6 — CID 134218618
N,N'-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]oxamide (PubChem CID 134218618) has the molecular formula C42H38N4O6 and a molecular weight of 694.79 g/mol. Its IUPAC name is N,N'-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]oxamide.
| Compound Name | N,N'-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]oxamide |
|---|---|
| PubChem CID | 134218618 |
| Molecular Formula | C42H38N4O6 |
| Molecular Weight | 694.79 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | N,N'-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]oxamide |
| SMILES | COc1ccc(N(c2ccc(NC(=O)C(=O)Nc3ccc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H38N4O6/c1-49-37-21-13-33(14-22-37)45(34-15-23-38(50-2)24-16-34)31-9-5-29(6-10-31)43-41(47)42(48)44-30-7-11-32(12-8-30)46(35-17-25-39(51-3)26-18-35)36-19-27-40(52-4)28-20-36/h5-28H,1-4H3,(H,43,47)(H,44,48) |
| InChIKey | PNGNLHXJANOTEN-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.79 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|