C46H40N4O8S — CID 134218819
3,4-dihydroxy-2-N,5-N-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophene-2,5-dicarboxamide (PubChem CID 134218819) has the molecular formula C46H40N4O8S and a molecular weight of 808.91 g/mol. Its IUPAC name is 3,4-dihydroxy-2-N,5-N-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophene-2,5-dicarboxamide.
| Compound Name | 3,4-dihydroxy-2-N,5-N-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 134218819 |
| Molecular Formula | C46H40N4O8S |
| Molecular Weight | 808.91 g/mol |
| Exact Mass | 808.26 |
| IUPAC Name | 3,4-dihydroxy-2-N,5-N-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophene-2,5-dicarboxamide |
| SMILES | COc1ccc(N(c2ccc(NC(=O)c3sc(C(=O)Nc4ccc(N(c5ccc(OC)cc5)c5ccc(OC)cc5)cc4)c(O)c3O)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C46H40N4O8S/c1-55-37-21-13-33(14-22-37)49(34-15-23-38(56-2)24-16-34)31-9-5-29(6-10-31)47-45(53)43-41(51)42(52)44(59-43)46(54)48-30-7-11-32(12-8-30)50(35-17-25-39(57-3)26-18-35)36-19-27-40(58-4)28-20-36/h5-28,51-52H,1-4H3,(H,47,53)(H,48,54) |
| InChIKey | VPKZVXKAWVCDEC-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 142.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.91 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|