C22H16F4N2O4 — CID 1014494
2,3,5,6-tetrafluoro-1-N,4-N-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide (PubChem CID 1014494) has the molecular formula C22H16F4N2O4 and a molecular weight of 448.37 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-1-N,4-N-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide.
| Compound Name | 2,3,5,6-tetrafluoro-1-N,4-N-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 1014494 |
| Molecular Formula | C22H16F4N2O4 |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 2,3,5,6-tetrafluoro-1-N,4-N-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide |
| SMILES | COc1ccc(NC(=O)c2c(F)c(F)c(C(=O)Nc3ccc(OC)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C22H16F4N2O4/c1-31-13-7-3-11(4-8-13)27-21(29)15-17(23)19(25)16(20(26)18(15)24)22(30)28-12-5-9-14(32-2)10-6-12/h3-10H,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | QJCWMDPVPFCPRF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|