C14H11Br2NO2 — CID 114023535
3,5-dibromo-N-(4-methoxyphenyl)benzamide (PubChem CID 114023535) has the molecular formula C14H11Br2NO2 and a molecular weight of 385.06 g/mol. Its IUPAC name is 3,5-dibromo-N-(4-methoxyphenyl)benzamide.
| Compound Name | 3,5-dibromo-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 114023535 |
| Molecular Formula | C14H11Br2NO2 |
| Molecular Weight | 385.06 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | 3,5-dibromo-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2cc(Br)cc(Br)c2)cc1 |
| InChI | InChI=1S/C14H11Br2NO2/c1-19-13-4-2-12(3-5-13)17-14(18)9-6-10(15)8-11(16)7-9/h2-8H,1H3,(H,17,18) |
| InChIKey | JJDDXYDOEDUYNW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.06 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |