C16H16BrNO3 — CID 104851763
3-bromo-N-(3,5-dimethoxyphenyl)-5-methylbenzamide (PubChem CID 104851763) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is 3-bromo-N-(3,5-dimethoxyphenyl)-5-methylbenzamide.
| Compound Name | 3-bromo-N-(3,5-dimethoxyphenyl)-5-methylbenzamide |
|---|---|
| PubChem CID | 104851763 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 3-bromo-N-(3,5-dimethoxyphenyl)-5-methylbenzamide |
| SMILES | COc1cc(NC(=O)c2cc(C)cc(Br)c2)cc(OC)c1 |
| InChI | InChI=1S/C16H16BrNO3/c1-10-4-11(6-12(17)5-10)16(19)18-13-7-14(20-2)9-15(8-13)21-3/h4-9H,1-3H3,(H,18,19) |
| InChIKey | IUQVKOQECVIQSB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |