C11H10BrN3O2 — CID 82859447
N-(3-bromo-5-methoxyphenyl)-1H-pyrazole-4-carboxamide (PubChem CID 82859447) has the molecular formula C11H10BrN3O2 and a molecular weight of 296.12 g/mol. Its IUPAC name is N-(3-bromo-5-methoxyphenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(3-bromo-5-methoxyphenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 82859447 |
| Molecular Formula | C11H10BrN3O2 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | N-(3-bromo-5-methoxyphenyl)-1H-pyrazole-4-carboxamide |
| SMILES | COc1cc(Br)cc(NC(=O)c2cn[nH]c2)c1 |
| InChI | InChI=1S/C11H10BrN3O2/c1-17-10-3-8(12)2-9(4-10)15-11(16)7-5-13-14-6-7/h2-6H,1H3,(H,13,14)(H,15,16) |
| InChIKey | VLDKUWMSUIEFHR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |