C28H23NO2S — CID 102296106
4-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]benzenethiol (PubChem CID 102296106) has the molecular formula C28H23NO2S and a molecular weight of 437.56 g/mol. Its IUPAC name is 4-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]benzenethiol.
| Compound Name | 4-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]benzenethiol |
|---|---|
| PubChem CID | 102296106 |
| Molecular Formula | C28H23NO2S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 4-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]benzenethiol |
| SMILES | COc1ccc(N(c2ccc(C#Cc3ccc(S)cc3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H23NO2S/c1-30-26-15-11-24(12-16-26)29(25-13-17-27(31-2)18-14-25)23-9-5-21(6-10-23)3-4-22-7-19-28(32)20-8-22/h5-20,32H,1-2H3 |
| InChIKey | WVXKGKBBQDCLHL-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|